C59H38N2 — CID 164988864
N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-4'-yl)-9-phenyl-N-(4-phenylphenyl)carbazol-2-amine (PubChem CID 164988864) has the molecular formula C59H38N2 and a molecular weight of 781.00 g/mol. Its IUPAC name is N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-4'-yl)-9-phenyl-N-(4-phenylphenyl)carbazol-2-amine.
| Compound Name | N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-4'-yl)-9-phenyl-N-(4-phenylphenyl)carbazol-2-amine |
|---|---|
| PubChem CID | 164988864 |
| Molecular Formula | C59H38N2 |
| Molecular Weight | 781.00 g/mol |
| Exact Mass | 780.34 |
| IUPAC Name | N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-4'-yl)-9-phenyl-N-(4-phenylphenyl)carbazol-2-amine |
| SMILES | [2H]c1c([2H])c2c3c(c([2H])c([2H])c([2H])c3c1[2H])C1(c3ccccc3-c3c(N(c4ccc(-c5ccccc5)cc4)c4ccc5c6ccccc6n(-c6ccccc6)c5c4)cccc31)c1ccccc1-2 |
| InChI | InChI=1S/C59H38N2/c1-3-16-39(17-4-1)40-32-34-43(35-33-40)60(44-36-37-47-46-23-9-12-30-54(46)61(56(47)38-44)42-20-5-2-6-21-42)55-31-15-29-53-58(55)49-24-8-11-27-51(49)59(53)50-26-10-7-22-45(50)48-25-13-18-41-19-14-28-52(59)57(41)48/h1-38H/i13D,14D,18D,19D,25D,28D |
| InChIKey | MEBDOAKPPXNBEY-RSTDJXRPSA-N |
| XLogP | 15.42 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.00 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |