C72H44N2 — CID 165069315
N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-4'-yl)-9-phenyl-N-(9,9'-spirobi[fluorene]-2-yl)carbazol-3-amine (PubChem CID 165069315) has the molecular formula C72H44N2 and a molecular weight of 943.19 g/mol. Its IUPAC name is N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-4'-yl)-9-phenyl-N-(9,9'-spirobi[fluorene]-2-yl)carbazol-3-amine.
| Compound Name | N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-4'-yl)-9-phenyl-N-(9,9'-spirobi[fluorene]-2-yl)carbazol-3-amine |
|---|---|
| PubChem CID | 165069315 |
| Molecular Formula | C72H44N2 |
| Molecular Weight | 943.19 g/mol |
| Exact Mass | 942.39 |
| IUPAC Name | N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-4'-yl)-9-phenyl-N-(9,9'-spirobi[fluorene]-2-yl)carbazol-3-amine |
| SMILES | [2H]c1c([2H])c2c3c(c([2H])c([2H])c([2H])c3c1[2H])C1(c3ccccc3-c3c(N(c4ccc5c(c4)C4(c6ccccc6-c6ccccc64)c4ccccc4-5)c4ccc5c(c4)c4ccccc4n5-c4ccccc4)cccc31)c1ccccc1-2 |
| InChI | InChI=1S/C72H44N2/c1-2-21-46(22-3-1)74-66-37-15-9-27-54(66)57-43-47(40-42-67(57)74)73(48-39-41-53-51-25-6-12-32-60(51)71(65(53)44-48)58-30-10-4-23-49(58)50-24-5-11-31-59(50)71)68-38-18-36-64-70(68)56-28-8-14-34-62(56)72(64)61-33-13-7-26-52(61)55-29-16-19-45-20-17-35-63(72)69(45)55/h1-44H/i16D,17D,19D,20D,29D,35D |
| InChIKey | MSORBVYTTJVLRI-QOUWKLOVSA-N |
| XLogP | 18.09 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.19 |
| LogP ≤ 5 | 18.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |