C59H36N2O — CID 165020402
N-dibenzofuran-1-yl-N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-2'-yl)-9-phenylcarbazol-3-amine (PubChem CID 165020402) has the molecular formula C59H36N2O and a molecular weight of 794.99 g/mol. Its IUPAC name is N-dibenzofuran-1-yl-N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-2'-yl)-9-phenylcarbazol-3-amine.
| Compound Name | N-dibenzofuran-1-yl-N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-2'-yl)-9-phenylcarbazol-3-amine |
|---|---|
| PubChem CID | 165020402 |
| Molecular Formula | C59H36N2O |
| Molecular Weight | 794.99 g/mol |
| Exact Mass | 794.32 |
| IUPAC Name | N-dibenzofuran-1-yl-N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-2'-yl)-9-phenylcarbazol-3-amine |
| SMILES | [2H]c1c([2H])c2c3c(c([2H])c([2H])c([2H])c3c1[2H])C1(c3ccccc3-c3ccc(N(c4ccc5c(c4)c4ccccc4n5-c4ccccc4)c4cccc5oc6ccccc6c45)cc31)c1ccccc1-2 |
| InChI | InChI=1S/C59H36N2O/c1-2-17-38(18-3-1)61-52-27-10-6-21-44(52)47-35-39(32-34-53(47)61)60(54-28-14-30-56-58(54)46-22-7-11-29-55(46)62-56)40-31-33-43-41-19-4-8-24-48(41)59(51(43)36-40)49-25-9-5-20-42(49)45-23-12-15-37-16-13-26-50(59)57(37)45/h1-36H/i12D,13D,15D,16D,23D,26D |
| InChIKey | XWJHCWJBTPCETM-JXDRHJRISA-N |
| XLogP | 15.65 |
| TPSA | 21.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.99 |
| LogP ≤ 5 | 15.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |