C59H36N2S — CID 164962740
N-dibenzothiophen-1-yl-N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-9-yl)-9-phenylcarbazol-3-amine (PubChem CID 164962740) has the molecular formula C59H36N2S and a molecular weight of 811.05 g/mol. Its IUPAC name is N-dibenzothiophen-1-yl-N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-9-yl)-9-phenylcarbazol-3-amine.
| Compound Name | N-dibenzothiophen-1-yl-N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-9-yl)-9-phenylcarbazol-3-amine |
|---|---|
| PubChem CID | 164962740 |
| Molecular Formula | C59H36N2S |
| Molecular Weight | 811.05 g/mol |
| Exact Mass | 810.30 |
| IUPAC Name | N-dibenzothiophen-1-yl-N-(1,2,3,4,5,6-hexadeuteriospiro[benzo[a]phenalene-7,9'-fluorene]-9-yl)-9-phenylcarbazol-3-amine |
| SMILES | [2H]c1c([2H])c2c3c(c([2H])c([2H])c([2H])c3c1[2H])C1(c3ccccc3-c3ccccc31)c1cc(N(c3ccc4c(c3)c3ccccc3n4-c3ccccc3)c3cccc4sc5ccccc5c34)ccc1-2 |
| InChI | InChI=1S/C59H36N2S/c1-2-17-38(18-3-1)61-52-27-10-6-21-44(52)47-35-39(32-34-53(47)61)60(54-28-14-30-56-58(54)46-22-7-11-29-55(46)62-56)40-31-33-43-45-23-12-15-37-16-13-26-50(57(37)45)59(51(43)36-40)48-24-8-4-19-41(48)42-20-5-9-25-49(42)59/h1-36H/i12D,13D,15D,16D,23D,26D |
| InChIKey | UVTOWSDZTIZFOB-JXDRHJRISA-N |
| XLogP | 16.12 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.05 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |