C29H31N3O3S — CID 164990885
4-[3-[6-(2,6-dimethylphenyl)-5-oxohexyl]-5-phenylpyrazol-1-yl]benzenesulfonamide (PubChem CID 164990885) has the molecular formula C29H31N3O3S and a molecular weight of 501.65 g/mol. Its IUPAC name is 4-[3-[6-(2,6-dimethylphenyl)-5-oxohexyl]-5-phenylpyrazol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[6-(2,6-dimethylphenyl)-5-oxohexyl]-5-phenylpyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 164990885 |
| Molecular Formula | C29H31N3O3S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 4-[3-[6-(2,6-dimethylphenyl)-5-oxohexyl]-5-phenylpyrazol-1-yl]benzenesulfonamide |
| SMILES | Cc1cccc(C)c1CC(=O)CCCCc1cc(-c2ccccc2)n(-c2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C29H31N3O3S/c1-21-9-8-10-22(2)28(21)20-26(33)14-7-6-13-24-19-29(23-11-4-3-5-12-23)32(31-24)25-15-17-27(18-16-25)36(30,34)35/h3-5,8-12,15-19H,6-7,13-14,20H2,1-2H3,(H2,30,34,35) |
| InChIKey | GVIWZEAANQCHHT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|