C39H48N6O6 — CID 164991299
4-[2,6-dimethoxy-4-(6-methyl-7-oxo-1H-pyrazolo[5,4-c]pyridin-4-yl)phenyl]-N-[3-[4-[4-[(2,4-dioxocyclohexyl)amino]phenyl]piperidin-1-yl]propyl]butanamide (PubChem CID 164991299) has the molecular formula C39H48N6O6 and a molecular weight of 696.85 g/mol. Its IUPAC name is 4-[2,6-dimethoxy-4-(6-methyl-7-oxo-1H-pyrazolo[5,4-c]pyridin-4-yl)phenyl]-N-[3-[4-[4-[(2,4-dioxocyclohexyl)amino]phenyl]piperidin-1-yl]propyl]butanamide.
| Compound Name | 4-[2,6-dimethoxy-4-(6-methyl-7-oxo-1H-pyrazolo[5,4-c]pyridin-4-yl)phenyl]-N-[3-[4-[4-[(2,4-dioxocyclohexyl)amino]phenyl]piperidin-1-yl]propyl]butanamide |
|---|---|
| PubChem CID | 164991299 |
| Molecular Formula | C39H48N6O6 |
| Molecular Weight | 696.85 g/mol |
| Exact Mass | 696.36 |
| IUPAC Name | 4-[2,6-dimethoxy-4-(6-methyl-7-oxo-1H-pyrazolo[5,4-c]pyridin-4-yl)phenyl]-N-[3-[4-[4-[(2,4-dioxocyclohexyl)amino]phenyl]piperidin-1-yl]propyl]butanamide |
| SMILES | COc1cc(-c2cn(C)c(=O)c3[nH]ncc23)cc(OC)c1CCCC(=O)NCCCN1CCC(c2ccc(NC3CCC(=O)CC3=O)cc2)CC1 |
| InChI | InChI=1S/C39H48N6O6/c1-44-24-32(31-23-41-43-38(31)39(44)49)27-20-35(50-2)30(36(21-27)51-3)6-4-7-37(48)40-16-5-17-45-18-14-26(15-19-45)25-8-10-28(11-9-25)42-33-13-12-29(46)22-34(33)47/h8-11,20-21,23-24,26,33,42H,4-7,12-19,22H2,1-3H3,(H,40,48)(H,41,43) |
| InChIKey | AREQUESGFLGYID-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 147.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.85 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|