C43H54N6O7 — CID 164991300
4-[2,6-dimethoxy-4-(6-methyl-7-oxo-1H-pyrazolo[5,4-c]pyridin-4-yl)phenyl]-N-[7-[4-[4-[(2,4-dioxocyclohexyl)amino]phenyl]piperidin-1-yl]-6-oxoheptyl]butanamide (PubChem CID 164991300) has the molecular formula C43H54N6O7 and a molecular weight of 766.94 g/mol. Its IUPAC name is 4-[2,6-dimethoxy-4-(6-methyl-7-oxo-1H-pyrazolo[5,4-c]pyridin-4-yl)phenyl]-N-[7-[4-[4-[(2,4-dioxocyclohexyl)amino]phenyl]piperidin-1-yl]-6-oxoheptyl]butanamide.
| Compound Name | 4-[2,6-dimethoxy-4-(6-methyl-7-oxo-1H-pyrazolo[5,4-c]pyridin-4-yl)phenyl]-N-[7-[4-[4-[(2,4-dioxocyclohexyl)amino]phenyl]piperidin-1-yl]-6-oxoheptyl]butanamide |
|---|---|
| PubChem CID | 164991300 |
| Molecular Formula | C43H54N6O7 |
| Molecular Weight | 766.94 g/mol |
| Exact Mass | 766.41 |
| IUPAC Name | 4-[2,6-dimethoxy-4-(6-methyl-7-oxo-1H-pyrazolo[5,4-c]pyridin-4-yl)phenyl]-N-[7-[4-[4-[(2,4-dioxocyclohexyl)amino]phenyl]piperidin-1-yl]-6-oxoheptyl]butanamide |
| SMILES | COc1cc(-c2cn(C)c(=O)c3[nH]ncc23)cc(OC)c1CCCC(=O)NCCCCCC(=O)CN1CCC(c2ccc(NC3CCC(=O)CC3=O)cc2)CC1 |
| InChI | InChI=1S/C43H54N6O7/c1-48-27-36(35-25-45-47-42(35)43(48)54)30-22-39(55-2)34(40(23-30)56-3)9-7-10-41(53)44-19-6-4-5-8-33(51)26-49-20-17-29(18-21-49)28-11-13-31(14-12-28)46-37-16-15-32(50)24-38(37)52/h11-14,22-23,25,27,29,37,46H,4-10,15-21,24,26H2,1-3H3,(H,44,53)(H,45,47) |
| InChIKey | MIQLHCJSDZKFRW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 164.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.94 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|