C17H21N — CID 165004844
(3S)-3-methyl-6-propan-2-yl-1,2,3,4-tetrahydroacridine (PubChem CID 165004844) has the molecular formula C17H21N and a molecular weight of 239.36 g/mol. Its IUPAC name is (3S)-3-methyl-6-propan-2-yl-1,2,3,4-tetrahydroacridine.
| Compound Name | (3S)-3-methyl-6-propan-2-yl-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 165004844 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (3S)-3-methyl-6-propan-2-yl-1,2,3,4-tetrahydroacridine |
| SMILES | CC(C)c1ccc2cc3c(nc2c1)C[C@@H](C)CC3 |
| InChI | InChI=1S/C17H21N/c1-11(2)13-6-7-15-9-14-5-4-12(3)8-16(14)18-17(15)10-13/h6-7,9-12H,4-5,8H2,1-3H3/t12-/m0/s1 |
| InChIKey | YWNIOTBUUFNOQS-LBPRGKRZSA-N |
| XLogP | 4.48 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |