About 2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine
2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine (PubChem CID 165013619) has the molecular formula C11H16IN
and a molecular weight of 289.16 g/mol. Its IUPAC name is 2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine.
Molecular Properties
| Compound Name | 2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine |
| PubChem CID | 165013619 |
| Molecular Formula | C11H16IN |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine |
| SMILES | C/I=C(\N)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C11H16IN/c1-11(2,10(13)12-3)9-7-5-4-6-8-9/h4-8H,13H2,1-3H3 |
| InChIKey | KBNFOBMVJJEJAZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine?
The IUPAC name of 2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine (CID 165013619) is 2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine.
What is the SMILES notation for 2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine?
The canonical SMILES for 2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine is C/I=C(\N)C(C)(C)c1ccccc1.
What is the InChIKey of 2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine?
The InChIKey is KBNFOBMVJJEJAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16IN/c1-11(2,10(13)12-3)9-7-5-4-6-8-9/h4-8H,13H2,1-3H3.
What are the key properties of 2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine?
2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine has a molecular weight of 289.16 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(methyl-λ3-iodanylidene)-2-phenylpropan-1-amine is sourced from PubChem (CID 165013619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).