C14H32O5S — CID 165014177
butanoic acid;2-methylpentan-2-ol;1-methylsulfonylpropane (PubChem CID 165014177) has the molecular formula C14H32O5S and a molecular weight of 312.47 g/mol. Its IUPAC name is butanoic acid;2-methylpentan-2-ol;1-methylsulfonylpropane.
| Compound Name | butanoic acid;2-methylpentan-2-ol;1-methylsulfonylpropane |
|---|---|
| PubChem CID | 165014177 |
| Molecular Formula | C14H32O5S |
| Molecular Weight | 312.47 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | butanoic acid;2-methylpentan-2-ol;1-methylsulfonylpropane |
| SMILES | CCCC(=O)O.CCCC(C)(C)O.CCCS(C)(=O)=O |
| InChI | InChI=1S/C6H14O.C4H10O2S.C4H8O2/c1-4-5-6(2,3)7;1-3-4-7(2,5)6;1-2-3-4(5)6/h7H,4-5H2,1-3H3;3-4H2,1-2H3;2-3H2,1H3,(H,5,6) |
| InChIKey | KDUCVIAPXHRCEC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |