C13H25N — CID 165018012
(1S)-4-tert-butyl-N-propylcyclohex-3-en-1-amine (PubChem CID 165018012) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (1S)-4-tert-butyl-N-propylcyclohex-3-en-1-amine.
| Compound Name | (1S)-4-tert-butyl-N-propylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 165018012 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (1S)-4-tert-butyl-N-propylcyclohex-3-en-1-amine |
| SMILES | CCCN[C@@H]1CC=C(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H25N/c1-5-10-14-12-8-6-11(7-9-12)13(2,3)4/h6,12,14H,5,7-10H2,1-4H3/t12-/m1/s1 |
| InChIKey | QXPKGDPCCBUPEN-GFCCVEGCSA-N |
| XLogP | 3.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|