C9H18N2 — CID 141400748
(1R)-1-N-propylcyclohex-3-ene-1,3-diamine (PubChem CID 141400748) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (1R)-1-N-propylcyclohex-3-ene-1,3-diamine.
| Compound Name | (1R)-1-N-propylcyclohex-3-ene-1,3-diamine |
|---|---|
| PubChem CID | 141400748 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (1R)-1-N-propylcyclohex-3-ene-1,3-diamine |
| SMILES | CCCN[C@@H]1CCC=C(N)C1 |
| InChI | InChI=1S/C9H18N2/c1-2-6-11-9-5-3-4-8(10)7-9/h4,9,11H,2-3,5-7,10H2,1H3/t9-/m1/s1 |
| InChIKey | LMZDJCWNXAVGJJ-SECBINFHSA-N |
| XLogP | 1.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |