C23H18N4O — CID 165019705
N-(1H-inden-5-yl)-8-methoxy-2-pyridin-4-ylquinazolin-4-amine (PubChem CID 165019705) has the molecular formula C23H18N4O and a molecular weight of 366.42 g/mol. Its IUPAC name is N-(1H-inden-5-yl)-8-methoxy-2-pyridin-4-ylquinazolin-4-amine.
| Compound Name | N-(1H-inden-5-yl)-8-methoxy-2-pyridin-4-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 165019705 |
| Molecular Formula | C23H18N4O |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-(1H-inden-5-yl)-8-methoxy-2-pyridin-4-ylquinazolin-4-amine |
| SMILES | COc1cccc2c(Nc3ccc4c(c3)C=CC4)nc(-c3ccncc3)nc12 |
| InChI | InChI=1S/C23H18N4O/c1-28-20-7-3-6-19-21(20)26-22(16-10-12-24-13-11-16)27-23(19)25-18-9-8-15-4-2-5-17(15)14-18/h2-3,5-14H,4H2,1H3,(H,25,26,27) |
| InChIKey | KZAJCWCUUXLPSX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |