C16H11ClN4 — CID 165037811
2-chloro-N-(1H-inden-5-yl)pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 165037811) has the molecular formula C16H11ClN4 and a molecular weight of 294.75 g/mol. Its IUPAC name is 2-chloro-N-(1H-inden-5-yl)pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(1H-inden-5-yl)pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 165037811 |
| Molecular Formula | C16H11ClN4 |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-chloro-N-(1H-inden-5-yl)pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Clc1nc(Nc2ccc3c(c2)C=CC3)c2ncccc2n1 |
| InChI | InChI=1S/C16H11ClN4/c17-16-20-13-5-2-8-18-14(13)15(21-16)19-12-7-6-10-3-1-4-11(10)9-12/h1-2,4-9H,3H2,(H,19,20,21) |
| InChIKey | YFASXVIYOZKNET-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |