C14H9ClN4O — CID 157282792
2-chloro-N-(1H-isoindol-5-yl)furo[3,2-d]pyrimidin-4-amine (PubChem CID 157282792) has the molecular formula C14H9ClN4O and a molecular weight of 284.71 g/mol. Its IUPAC name is 2-chloro-N-(1H-isoindol-5-yl)furo[3,2-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-N-(1H-isoindol-5-yl)furo[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 157282792 |
| Molecular Formula | C14H9ClN4O |
| Molecular Weight | 284.71 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 2-chloro-N-(1H-isoindol-5-yl)furo[3,2-d]pyrimidin-4-amine |
| SMILES | Clc1nc(Nc2ccc3c(c2)C=NC3)c2occc2n1 |
| InChI | InChI=1S/C14H9ClN4O/c15-14-18-11-3-4-20-12(11)13(19-14)17-10-2-1-8-6-16-7-9(8)5-10/h1-5,7H,6H2,(H,17,18,19) |
| InChIKey | CYUDRUQZSQYTBY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.71 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |