C12H7ClN2O — CID 118682597
2-chloro-4-phenylfuro[3,2-d]pyrimidine (PubChem CID 118682597) has the molecular formula C12H7ClN2O and a molecular weight of 230.65 g/mol. Its IUPAC name is 2-chloro-4-phenylfuro[3,2-d]pyrimidine.
| Compound Name | 2-chloro-4-phenylfuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 118682597 |
| Molecular Formula | C12H7ClN2O |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 2-chloro-4-phenylfuro[3,2-d]pyrimidine |
| SMILES | Clc1nc(-c2ccccc2)c2occc2n1 |
| InChI | InChI=1S/C12H7ClN2O/c13-12-14-9-6-7-16-11(9)10(15-12)8-4-2-1-3-5-8/h1-7H |
| InChIKey | CONYZOGVLYRDAH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |