C18H11ClN2O — CID 118682601
2-chloro-4-(3-phenylphenyl)furo[2,3-d]pyrimidine (PubChem CID 118682601) has the molecular formula C18H11ClN2O and a molecular weight of 306.75 g/mol. Its IUPAC name is 2-chloro-4-(3-phenylphenyl)furo[2,3-d]pyrimidine.
| Compound Name | 2-chloro-4-(3-phenylphenyl)furo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 118682601 |
| Molecular Formula | C18H11ClN2O |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-chloro-4-(3-phenylphenyl)furo[2,3-d]pyrimidine |
| SMILES | Clc1nc(-c2cccc(-c3ccccc3)c2)c2ccoc2n1 |
| InChI | InChI=1S/C18H11ClN2O/c19-18-20-16(15-9-10-22-17(15)21-18)14-8-4-7-13(11-14)12-5-2-1-3-6-12/h1-11H |
| InChIKey | GPAQNMZVGOYGFJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |