C18H13NO — CID 166570103
4-(4-methylphenyl)furo[2,3-c]quinoline (PubChem CID 166570103) has the molecular formula C18H13NO and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-(4-methylphenyl)furo[2,3-c]quinoline.
| Compound Name | 4-(4-methylphenyl)furo[2,3-c]quinoline |
|---|---|
| PubChem CID | 166570103 |
| Molecular Formula | C18H13NO |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-(4-methylphenyl)furo[2,3-c]quinoline |
| SMILES | Cc1ccc(-c2nc3ccccc3c3ccoc23)cc1 |
| InChI | InChI=1S/C18H13NO/c1-12-6-8-13(9-7-12)17-18-15(10-11-20-18)14-4-2-3-5-16(14)19-17/h2-11H,1H3 |
| InChIKey | AMHUKDKUEXVQSG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |