C21H20F4O6S — CID 165020565
[1,1-difluoro-3-(2-phenyl-1,3-dioxolan-2-yl)propan-2-yl] 1,1-difluoro-2-oxo-3-phenylpropane-1-sulfonate (PubChem CID 165020565) has the molecular formula C21H20F4O6S and a molecular weight of 476.44 g/mol. Its IUPAC name is [1,1-difluoro-3-(2-phenyl-1,3-dioxolan-2-yl)propan-2-yl] 1,1-difluoro-2-oxo-3-phenylpropane-1-sulfonate.
| Compound Name | [1,1-difluoro-3-(2-phenyl-1,3-dioxolan-2-yl)propan-2-yl] 1,1-difluoro-2-oxo-3-phenylpropane-1-sulfonate |
|---|---|
| PubChem CID | 165020565 |
| Molecular Formula | C21H20F4O6S |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | [1,1-difluoro-3-(2-phenyl-1,3-dioxolan-2-yl)propan-2-yl] 1,1-difluoro-2-oxo-3-phenylpropane-1-sulfonate |
| SMILES | O=C(Cc1ccccc1)C(F)(F)S(=O)(=O)OC(CC1(c2ccccc2)OCCO1)C(F)F |
| InChI | InChI=1S/C21H20F4O6S/c22-19(23)17(14-20(29-11-12-30-20)16-9-5-2-6-10-16)31-32(27,28)21(24,25)18(26)13-15-7-3-1-4-8-15/h1-10,17,19H,11-14H2 |
| InChIKey | LCCWNOJIXJYWOU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|