C18H18FN5O2 — CID 165021907
5-[5-amino-2-(oxan-4-ylamino)pyrido[4,3-d]pyrimidin-8-yl]-2-fluorophenol (PubChem CID 165021907) has the molecular formula C18H18FN5O2 and a molecular weight of 355.37 g/mol. Its IUPAC name is 5-[5-amino-2-(oxan-4-ylamino)pyrido[4,3-d]pyrimidin-8-yl]-2-fluorophenol.
| Compound Name | 5-[5-amino-2-(oxan-4-ylamino)pyrido[4,3-d]pyrimidin-8-yl]-2-fluorophenol |
|---|---|
| PubChem CID | 165021907 |
| Molecular Formula | C18H18FN5O2 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 5-[5-amino-2-(oxan-4-ylamino)pyrido[4,3-d]pyrimidin-8-yl]-2-fluorophenol |
| SMILES | Nc1ncc(-c2ccc(F)c(O)c2)c2nc(NC3CCOCC3)ncc12 |
| InChI | InChI=1S/C18H18FN5O2/c19-14-2-1-10(7-15(14)25)12-8-21-17(20)13-9-22-18(24-16(12)13)23-11-3-5-26-6-4-11/h1-2,7-9,11,25H,3-6H2,(H2,20,21)(H,22,23,24) |
| InChIKey | LHDBZMLDMNRNDK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |