C19H20FN5 — CID 175705974
2-N-cyclohexyl-8-(4-fluorophenyl)pyrido[4,3-d]pyrimidine-2,5-diamine (PubChem CID 175705974) has the molecular formula C19H20FN5 and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-N-cyclohexyl-8-(4-fluorophenyl)pyrido[4,3-d]pyrimidine-2,5-diamine.
| Compound Name | 2-N-cyclohexyl-8-(4-fluorophenyl)pyrido[4,3-d]pyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 175705974 |
| Molecular Formula | C19H20FN5 |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-N-cyclohexyl-8-(4-fluorophenyl)pyrido[4,3-d]pyrimidine-2,5-diamine |
| SMILES | Nc1ncc(-c2ccc(F)cc2)c2nc(NC3CCCCC3)ncc12 |
| InChI | InChI=1S/C19H20FN5/c20-13-8-6-12(7-9-13)15-10-22-18(21)16-11-23-19(25-17(15)16)24-14-4-2-1-3-5-14/h6-11,14H,1-5H2,(H2,21,22)(H,23,24,25) |
| InChIKey | SGMZKUIQDVXZBE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |