C25H17Br3N4 — CID 165025943
2-bromo-9-deuterio-1,10-phenanthroline;2,9-dibromo-1,10-phenanthroline;methane (PubChem CID 165025943) has the molecular formula C25H17Br3N4 and a molecular weight of 614.16 g/mol. Its IUPAC name is 2-bromo-9-deuterio-1,10-phenanthroline;2,9-dibromo-1,10-phenanthroline;methane.
| Compound Name | 2-bromo-9-deuterio-1,10-phenanthroline;2,9-dibromo-1,10-phenanthroline;methane |
|---|---|
| PubChem CID | 165025943 |
| Molecular Formula | C25H17Br3N4 |
| Molecular Weight | 614.16 g/mol |
| Exact Mass | 610.91 |
| IUPAC Name | 2-bromo-9-deuterio-1,10-phenanthroline;2,9-dibromo-1,10-phenanthroline;methane |
| SMILES | Brc1ccc2ccc3ccc(Br)nc3c2n1.C.[2H]c1ccc2ccc3ccc(Br)nc3c2n1 |
| InChI | InChI=1S/C12H6Br2N2.C12H7BrN2.CH4/c13-9-5-3-7-1-2-8-4-6-10(14)16-12(8)11(7)15-9;13-10-6-5-9-4-3-8-2-1-7-14-11(8)12(9)15-10;/h1-6H;1-7H;1H4/i;7D; |
| InChIKey | LWQNCPXTPFQWGJ-UUGAVVTLSA-N |
| XLogP | 8.49 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.16 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|