About dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole
dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole (PubChem CID 165029762) has the molecular formula C17H34N6Sn
and a molecular weight of 441.21 g/mol. Its IUPAC name is dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole.
Molecular Properties
| Compound Name | dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole |
| PubChem CID | 165029762 |
| Molecular Formula | C17H34N6Sn |
| Molecular Weight | 441.21 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole |
| SMILES | CCCC[Sn](CCC)(CCCC)c1cnnn1C.Cn1ccnn1 |
| InChI | InChI=1S/2C4H9.C3H5N3.C3H4N3.C3H7.Sn/c2*1-3-4-2;2*1-6-3-2-4-5-6;1-3-2;/h2*1,3-4H2,2H3;2-3H,1H3;2H,1H3;1,3H2,2H3; |
| InChIKey | MLPMNAXANYYKLU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.21 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole?
The IUPAC name of dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole (CID 165029762) is dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole.
What is the SMILES notation for dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole?
The canonical SMILES for dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole is CCCC[Sn](CCC)(CCCC)c1cnnn1C.Cn1ccnn1.
What is the InChIKey of dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole?
The InChIKey is MLPMNAXANYYKLU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H9.C3H5N3.C3H4N3.C3H7.Sn/c2*1-3-4-2;2*1-6-3-2-4-5-6;1-3-2;/h2*1,3-4H2,2H3;2-3H,1H3;2H,1H3;1,3H2,2H3;.
What are the key properties of dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole?
dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole has a molecular weight of 441.21 g/mol, XLogP of 3.30, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl-(3-methyltriazol-4-yl)-propylstannane;1-methyltriazole is sourced from PubChem (CID 165029762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).