C15H29NSSn — CID 145083761
dibutyl-(2-methyl-1,3-thiazol-5-yl)-propylstannane (PubChem CID 145083761) has the molecular formula C15H29NSSn and a molecular weight of 374.18 g/mol. Its IUPAC name is dibutyl-(2-methyl-1,3-thiazol-5-yl)-propylstannane.
| Compound Name | dibutyl-(2-methyl-1,3-thiazol-5-yl)-propylstannane |
|---|---|
| PubChem CID | 145083761 |
| Molecular Formula | C15H29NSSn |
| Molecular Weight | 374.18 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | dibutyl-(2-methyl-1,3-thiazol-5-yl)-propylstannane |
| SMILES | CCCC[Sn](CCC)(CCCC)c1cnc(C)s1 |
| InChI | InChI=1S/C4H4NS.2C4H9.C3H7.Sn/c1-4-5-2-3-6-4;2*1-3-4-2;1-3-2;/h2H,1H3;2*1,3-4H2,2H3;1,3H2,2H3; |
| InChIKey | OWFLMUOOBLELJI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.18 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |