C19H36N2O2SSn — CID 44630562
propan-2-yl N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate (PubChem CID 44630562) has the molecular formula C19H36N2O2SSn and a molecular weight of 475.29 g/mol. Its IUPAC name is propan-2-yl N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate.
| Compound Name | propan-2-yl N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 44630562 |
| Molecular Formula | C19H36N2O2SSn |
| Molecular Weight | 475.29 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | propan-2-yl N-(5-tributylstannyl-1,3-thiazol-2-yl)carbamate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cnc(NC(=O)OC(C)C)s1 |
| InChI | InChI=1S/C7H9N2O2S.3C4H9.Sn/c1-5(2)11-7(10)9-6-8-3-4-12-6;3*1-3-4-2;/h3,5H,1-2H3,(H,8,9,10);3*1,3-4H2,2H3; |
| InChIKey | IWMHUDUYTCIEKV-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.29 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |