C16H31NSSn — CID 155728954
dibutyl-(3-methylbutyl)-(1,3-thiazol-5-yl)stannane (PubChem CID 155728954) has the molecular formula C16H31NSSn and a molecular weight of 388.21 g/mol. Its IUPAC name is dibutyl-(3-methylbutyl)-(1,3-thiazol-5-yl)stannane.
| Compound Name | dibutyl-(3-methylbutyl)-(1,3-thiazol-5-yl)stannane |
|---|---|
| PubChem CID | 155728954 |
| Molecular Formula | C16H31NSSn |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | dibutyl-(3-methylbutyl)-(1,3-thiazol-5-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCC(C)C)c1cncs1 |
| InChI | InChI=1S/C5H11.2C4H9.C3H2NS.Sn/c1-4-5(2)3;2*1-3-4-2;1-2-5-3-4-1;/h5H,1,4H2,2-3H3;2*1,3-4H2,2H3;1,3H; |
| InChIKey | SIQUWZVQGPVLKL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |