C15H12N4O3S — CID 165031377
2-(5-nitro-1,3-thiazol-2-yl)-1-[1-(pyridin-4-ylmethyl)pyrrol-2-yl]ethanone (PubChem CID 165031377) has the molecular formula C15H12N4O3S and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-(5-nitro-1,3-thiazol-2-yl)-1-[1-(pyridin-4-ylmethyl)pyrrol-2-yl]ethanone.
| Compound Name | 2-(5-nitro-1,3-thiazol-2-yl)-1-[1-(pyridin-4-ylmethyl)pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 165031377 |
| Molecular Formula | C15H12N4O3S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-(5-nitro-1,3-thiazol-2-yl)-1-[1-(pyridin-4-ylmethyl)pyrrol-2-yl]ethanone |
| SMILES | O=C(Cc1ncc([N+](=O)[O-])s1)c1cccn1Cc1ccncc1 |
| InChI | InChI=1S/C15H12N4O3S/c20-13(8-14-17-9-15(23-14)19(21)22)12-2-1-7-18(12)10-11-3-5-16-6-4-11/h1-7,9H,8,10H2 |
| InChIKey | UPICIHAWMWQFMC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|