C18H23FN4O2 — CID 165034414
tert-butyl (2S,4S)-4-(4-cyano-5-ethyl-3-ethynylpyrazol-1-yl)-2-(fluoromethyl)pyrrolidine-1-carboxylate (PubChem CID 165034414) has the molecular formula C18H23FN4O2 and a molecular weight of 346.41 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-(4-cyano-5-ethyl-3-ethynylpyrazol-1-yl)-2-(fluoromethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-(4-cyano-5-ethyl-3-ethynylpyrazol-1-yl)-2-(fluoromethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 165034414 |
| Molecular Formula | C18H23FN4O2 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | tert-butyl (2S,4S)-4-(4-cyano-5-ethyl-3-ethynylpyrazol-1-yl)-2-(fluoromethyl)pyrrolidine-1-carboxylate |
| SMILES | C#Cc1nn([C@H]2C[C@@H](CF)N(C(=O)OC(C)(C)C)C2)c(CC)c1C#N |
| InChI | InChI=1S/C18H23FN4O2/c1-6-15-14(10-20)16(7-2)23(21-15)13-8-12(9-19)22(11-13)17(24)25-18(3,4)5/h1,12-13H,7-9,11H2,2-5H3/t12-,13-/m0/s1 |
| InChIKey | OXZXWQWDTSKXDM-STQMWFEESA-N |
| XLogP | 2.82 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|