C20H29N2Ru — CID 165040083
(1R)-1,2,3,4,4,5,5,8,9-nonamethyl-1,7-dihydroimidazo[1,5-a]quinolin-7-ide;ruthenium(1+) (PubChem CID 165040083) has the molecular formula C20H29N2Ru and a molecular weight of 398.54 g/mol. Its IUPAC name is (1R)-1,2,3,4,4,5,5,8,9-nonamethyl-1,7-dihydroimidazo[1,5-a]quinolin-7-ide;ruthenium(1+).
| Compound Name | (1R)-1,2,3,4,4,5,5,8,9-nonamethyl-1,7-dihydroimidazo[1,5-a]quinolin-7-ide;ruthenium(1+) |
|---|---|
| PubChem CID | 165040083 |
| Molecular Formula | C20H29N2Ru |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (1R)-1,2,3,4,4,5,5,8,9-nonamethyl-1,7-dihydroimidazo[1,5-a]quinolin-7-ide;ruthenium(1+) |
| SMILES | CC1=C2N(c3c(c[c-]c(C)c3C)C(C)(C)C2(C)C)[C@H](C)N1C.[Ru+] |
| InChI | InChI=1S/C20H29N2.Ru/c1-12-10-11-16-17(13(12)2)22-15(4)21(9)14(3)18(22)20(7,8)19(16,5)6;/h11,15H,1-9H3;/q-1;+1/t15-;/m1./s1 |
| InChIKey | HKBBUVZAJNPFLM-XFULWGLBSA-N |
| XLogP | 4.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|