C32H29NO2 — CID 165040105
3-methyl-5-phenylmethoxy-1H-indole;5-phenylmethoxy-1H-indene (PubChem CID 165040105) has the molecular formula C32H29NO2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 3-methyl-5-phenylmethoxy-1H-indole;5-phenylmethoxy-1H-indene.
| Compound Name | 3-methyl-5-phenylmethoxy-1H-indole;5-phenylmethoxy-1H-indene |
|---|---|
| PubChem CID | 165040105 |
| Molecular Formula | C32H29NO2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 3-methyl-5-phenylmethoxy-1H-indole;5-phenylmethoxy-1H-indene |
| SMILES | C1=Cc2cc(OCc3ccccc3)ccc2C1.Cc1c[nH]c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C16H15NO.C16H14O/c1-12-10-17-16-8-7-14(9-15(12)16)18-11-13-5-3-2-4-6-13;1-2-5-13(6-3-1)12-17-16-10-9-14-7-4-8-15(14)11-16/h2-10,17H,11H2,1H3;1-6,8-11H,7,12H2 |
| InChIKey | NZEXHHDSCSFEES-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |