C24H25Cl2IN8O2 — CID 165041768
2-chloro-3-iodopyridine;(2-chloro-3-pyridinyl)-[1-(cyclopropylmethyl)triazol-4-yl]methanol;1-(cyclopropylmethyl)triazole-4-carbaldehyde (PubChem CID 165041768) has the molecular formula C24H25Cl2IN8O2 and a molecular weight of 655.33 g/mol. Its IUPAC name is 2-chloro-3-iodopyridine;(2-chloro-3-pyridinyl)-[1-(cyclopropylmethyl)triazol-4-yl]methanol;1-(cyclopropylmethyl)triazole-4-carbaldehyde.
| Compound Name | 2-chloro-3-iodopyridine;(2-chloro-3-pyridinyl)-[1-(cyclopropylmethyl)triazol-4-yl]methanol;1-(cyclopropylmethyl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 165041768 |
| Molecular Formula | C24H25Cl2IN8O2 |
| Molecular Weight | 655.33 g/mol |
| Exact Mass | 654.05 |
| IUPAC Name | 2-chloro-3-iodopyridine;(2-chloro-3-pyridinyl)-[1-(cyclopropylmethyl)triazol-4-yl]methanol;1-(cyclopropylmethyl)triazole-4-carbaldehyde |
| SMILES | Clc1ncccc1I.O=Cc1cn(CC2CC2)nn1.OC(c1cn(CC2CC2)nn1)c1cccnc1Cl |
| InChI | InChI=1S/C12H13ClN4O.C7H9N3O.C5H3ClIN/c13-12-9(2-1-5-14-12)11(18)10-7-17(16-15-10)6-8-3-4-8;11-5-7-4-10(9-8-7)3-6-1-2-6;6-5-4(7)2-1-3-8-5/h1-2,5,7-8,11,18H,3-4,6H2;4-6H,1-3H2;1-3H |
| InChIKey | OFYJQZKLFPUOEW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|