C24H24Cl2F2N8O2 — CID 165061771
azidomethylcyclopropane;(2-chloro-5-fluoro-3-pyridinyl)-[1-(cyclopropylmethyl)triazol-4-yl]methanol;1-(2-chloro-5-fluoro-3-pyridinyl)prop-2-yn-1-ol (PubChem CID 165061771) has the molecular formula C24H24Cl2F2N8O2 and a molecular weight of 565.41 g/mol. Its IUPAC name is azidomethylcyclopropane;(2-chloro-5-fluoro-3-pyridinyl)-[1-(cyclopropylmethyl)triazol-4-yl]methanol;1-(2-chloro-5-fluoro-3-pyridinyl)prop-2-yn-1-ol.
| Compound Name | azidomethylcyclopropane;(2-chloro-5-fluoro-3-pyridinyl)-[1-(cyclopropylmethyl)triazol-4-yl]methanol;1-(2-chloro-5-fluoro-3-pyridinyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 165061771 |
| Molecular Formula | C24H24Cl2F2N8O2 |
| Molecular Weight | 565.41 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | azidomethylcyclopropane;(2-chloro-5-fluoro-3-pyridinyl)-[1-(cyclopropylmethyl)triazol-4-yl]methanol;1-(2-chloro-5-fluoro-3-pyridinyl)prop-2-yn-1-ol |
| SMILES | C#CC(O)c1cc(F)cnc1Cl.OC(c1cn(CC2CC2)nn1)c1cc(F)cnc1Cl.[N-]=[N+]=NCC1CC1 |
| InChI | InChI=1S/C12H12ClFN4O.C8H5ClFNO.C4H7N3/c13-12-9(3-8(14)4-15-12)11(19)10-6-18(17-16-10)5-7-1-2-7;1-2-7(12)6-3-5(10)4-11-8(6)9;5-7-6-3-4-1-2-4/h3-4,6-7,11,19H,1-2,5H2;1,3-4,7,12H;4H,1-3H2 |
| InChIKey | RIBNKMIYDWJDSQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.41 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|