C15H26FN — CID 165045050
(1S)-4-tert-butyl-N-(3-fluoro-3-methylcyclobutyl)cyclohex-3-en-1-amine (PubChem CID 165045050) has the molecular formula C15H26FN and a molecular weight of 239.38 g/mol. Its IUPAC name is (1S)-4-tert-butyl-N-(3-fluoro-3-methylcyclobutyl)cyclohex-3-en-1-amine.
| Compound Name | (1S)-4-tert-butyl-N-(3-fluoro-3-methylcyclobutyl)cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 165045050 |
| Molecular Formula | C15H26FN |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | (1S)-4-tert-butyl-N-(3-fluoro-3-methylcyclobutyl)cyclohex-3-en-1-amine |
| SMILES | CC1(F)CC(N[C@@H]2CC=C(C(C)(C)C)CC2)C1 |
| InChI | InChI=1S/C15H26FN/c1-14(2,3)11-5-7-12(8-6-11)17-13-9-15(4,16)10-13/h5,12-13,17H,6-10H2,1-4H3/t12-,13?,15?/m1/s1 |
| InChIKey | OMNOBWTWWOSPNC-DNOWBOINSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|