C16H23F4NO2Si — CID 165047980
N-methyl-N-[2-[4-(1,1,2,2-tetrafluoro-2-trimethylsilylethoxy)phenyl]ethyl]acetamide (PubChem CID 165047980) has the molecular formula C16H23F4NO2Si and a molecular weight of 365.44 g/mol. Its IUPAC name is N-methyl-N-[2-[4-(1,1,2,2-tetrafluoro-2-trimethylsilylethoxy)phenyl]ethyl]acetamide.
| Compound Name | N-methyl-N-[2-[4-(1,1,2,2-tetrafluoro-2-trimethylsilylethoxy)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 165047980 |
| Molecular Formula | C16H23F4NO2Si |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-methyl-N-[2-[4-(1,1,2,2-tetrafluoro-2-trimethylsilylethoxy)phenyl]ethyl]acetamide |
| SMILES | CC(=O)N(C)CCc1ccc(OC(F)(F)C(F)(F)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C16H23F4NO2Si/c1-12(22)21(2)11-10-13-6-8-14(9-7-13)23-15(17,18)16(19,20)24(3,4)5/h6-9H,10-11H2,1-5H3 |
| InChIKey | QZUKWNLFADHSSC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|