About (E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one
(E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one (PubChem CID 165049361) has the molecular formula C13H21FO4
and a molecular weight of 260.30 g/mol. Its IUPAC name is (E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one.
Molecular Properties
| Compound Name | (E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one |
| PubChem CID | 165049361 |
| Molecular Formula | C13H21FO4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one |
| SMILES | C=C(CC(C)=O)OCC.CCO/C=C(/F)C(C)=O |
| InChI | InChI=1S/C7H12O2.C6H9FO2/c1-4-9-7(3)5-6(2)8;1-3-9-4-6(7)5(2)8/h3-5H2,1-2H3;4H,3H2,1-2H3/b;6-4+ |
| InChIKey | PKNSPHGNDFANRW-DVXCEAISSA-N |
| XLogP | 2.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one?
The IUPAC name of (E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one (CID 165049361) is (E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one.
What is the SMILES notation for (E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one?
The canonical SMILES for (E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one is C=C(CC(C)=O)OCC.CCO/C=C(/F)C(C)=O.
What is the InChIKey of (E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one?
The InChIKey is PKNSPHGNDFANRW-DVXCEAISSA-N. The full InChI is InChI=1S/C7H12O2.C6H9FO2/c1-4-9-7(3)5-6(2)8;1-3-9-4-6(7)5(2)8/h3-5H2,1-2H3;4H,3H2,1-2H3/b;6-4+.
What are the key properties of (E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one?
(E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one has a molecular weight of 260.30 g/mol, XLogP of 2.94, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-ethoxy-3-fluorobut-3-en-2-one;4-ethoxypent-4-en-2-one is sourced from PubChem (CID 165049361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).