C9H16O3 — CID 25214409
(E)-1,5-diethoxy(2,4-13C2)pent-1-en-3-one (PubChem CID 25214409) has the molecular formula C9H16O3 and a molecular weight of 174.21 g/mol. Its IUPAC name is (E)-1,5-diethoxy(2,4-13C2)pent-1-en-3-one.
| Compound Name | (E)-1,5-diethoxy(2,4-13C2)pent-1-en-3-one |
|---|---|
| PubChem CID | 25214409 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (E)-1,5-diethoxy(2,4-13C2)pent-1-en-3-one |
| SMILES | CCO/C=[13CH]/C(=O)[13CH2]COCC |
| InChI | InChI=1S/C9H16O3/c1-3-11-7-5-9(10)6-8-12-4-2/h5,7H,3-4,6,8H2,1-2H3/b7-5+/i5+1,6+1 |
| InChIKey | FICUXUYVSNCWNL-AZEKHQJXSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|