C18H23N3O4 — CID 165055893
7-(5-aminopentyl)-2-(2,6-dioxopiperidin-3-yl)-4,5-dihydroisoindole-1,3-dione (PubChem CID 165055893) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 7-(5-aminopentyl)-2-(2,6-dioxopiperidin-3-yl)-4,5-dihydroisoindole-1,3-dione.
| Compound Name | 7-(5-aminopentyl)-2-(2,6-dioxopiperidin-3-yl)-4,5-dihydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 165055893 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 7-(5-aminopentyl)-2-(2,6-dioxopiperidin-3-yl)-4,5-dihydroisoindole-1,3-dione |
| SMILES | NCCCCCC1=CCCC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C18H23N3O4/c19-10-3-1-2-5-11-6-4-7-12-15(11)18(25)21(17(12)24)13-8-9-14(22)20-16(13)23/h6,13H,1-5,7-10,19H2,(H,20,22,23) |
| InChIKey | QKHUKWFIVVLXPR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|