C19H23FN4O4 — CID 171158312
5-[5-aminopentyl(methyl)amino]-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione (PubChem CID 171158312) has the molecular formula C19H23FN4O4 and a molecular weight of 390.42 g/mol. Its IUPAC name is 5-[5-aminopentyl(methyl)amino]-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione.
| Compound Name | 5-[5-aminopentyl(methyl)amino]-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 171158312 |
| Molecular Formula | C19H23FN4O4 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 5-[5-aminopentyl(methyl)amino]-2-(2,6-dioxopiperidin-3-yl)-6-fluoroisoindole-1,3-dione |
| SMILES | CN(CCCCCN)c1cc2c(cc1F)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C19H23FN4O4/c1-23(8-4-2-3-7-21)15-10-12-11(9-13(15)20)18(27)24(19(12)28)14-5-6-16(25)22-17(14)26/h9-10,14H,2-8,21H2,1H3,(H,22,25,26) |
| InChIKey | DCORVKNVMVAEND-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|