C28H48O4 — CID 165056700
ethyl 6-methyl-3-prop-1-en-2-ylhept-6-enoate;6-methyl-3-prop-1-en-2-ylhept-6-enal;oxolane (PubChem CID 165056700) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is ethyl 6-methyl-3-prop-1-en-2-ylhept-6-enoate;6-methyl-3-prop-1-en-2-ylhept-6-enal;oxolane.
| Compound Name | ethyl 6-methyl-3-prop-1-en-2-ylhept-6-enoate;6-methyl-3-prop-1-en-2-ylhept-6-enal;oxolane |
|---|---|
| PubChem CID | 165056700 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | ethyl 6-methyl-3-prop-1-en-2-ylhept-6-enoate;6-methyl-3-prop-1-en-2-ylhept-6-enal;oxolane |
| SMILES | C1CCOC1.C=C(C)CCC(CC(=O)OCC)C(=C)C.C=C(C)CCC(CC=O)C(=C)C |
| InChI | InChI=1S/C13H22O2.C11H18O.C4H8O/c1-6-15-13(14)9-12(11(4)5)8-7-10(2)3;1-9(2)5-6-11(7-8-12)10(3)4;1-2-4-5-3-1/h12H,2,4,6-9H2,1,3,5H3;8,11H,1,3,5-7H2,2,4H3;1-4H2 |
| InChIKey | QNVWYHYQPUTQCH-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|