C23H40O3 — CID 58626887
3-(4,6,8,10,12-pentamethyl-2-methylidenetridecyl)oxolane-2,5-dione (PubChem CID 58626887) has the molecular formula C23H40O3 and a molecular weight of 364.57 g/mol. Its IUPAC name is 3-(4,6,8,10,12-pentamethyl-2-methylidenetridecyl)oxolane-2,5-dione.
| Compound Name | 3-(4,6,8,10,12-pentamethyl-2-methylidenetridecyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 58626887 |
| Molecular Formula | C23H40O3 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | 3-(4,6,8,10,12-pentamethyl-2-methylidenetridecyl)oxolane-2,5-dione |
| SMILES | C=C(CC(C)CC(C)CC(C)CC(C)CC(C)C)CC1CC(=O)OC1=O |
| InChI | InChI=1S/C23H40O3/c1-15(2)8-16(3)9-17(4)10-18(5)11-19(6)12-20(7)13-21-14-22(24)26-23(21)25/h15-19,21H,7-14H2,1-6H3 |
| InChIKey | FKGAHGWOFIGYJO-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|