About 6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate
6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate (PubChem CID 165058234) has the molecular formula C40H80Br2O5
and a molecular weight of 800.88 g/mol. Its IUPAC name is 6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate.
Molecular Properties
| Compound Name | 6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate |
| PubChem CID | 165058234 |
| Molecular Formula | C40H80Br2O5 |
| Molecular Weight | 800.88 g/mol |
| Exact Mass | 798.44 |
| IUPAC Name | 6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate |
| SMILES | CCCCCCC(CCCCCC)COC(=O)CCCCCBr.CCCCCCC(CO)CCCCCC.O=C(O)CCCCCBr |
| InChI | InChI=1S/C20H39BrO2.C14H30O.C6H11BrO2/c1-3-5-7-10-14-19(15-11-8-6-4-2)18-23-20(22)16-12-9-13-17-21;1-3-5-7-9-11-14(13-15)12-10-8-6-4-2;7-5-3-1-2-4-6(8)9/h19H,3-18H2,1-2H3;14-15H,3-13H2,1-2H3;1-5H2,(H,8,9) |
| InChIKey | QTZUHQHBQCFTIA-UHFFFAOYSA-N |
| XLogP | 13.60 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 800.88 |
| LogP ≤ 5 | 13.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate?
The IUPAC name of 6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate (CID 165058234) is 6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate.
What is the SMILES notation for 6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate?
The canonical SMILES for 6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate is CCCCCCC(CCCCCC)COC(=O)CCCCCBr.CCCCCCC(CO)CCCCCC.O=C(O)CCCCCBr.
What is the InChIKey of 6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate?
The InChIKey is QTZUHQHBQCFTIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39BrO2.C14H30O.C6H11BrO2/c1-3-5-7-10-14-19(15-11-8-6-4-2)18-23-20(22)16-12-9-13-17-21;1-3-5-7-9-11-14(13-15)12-10-8-6-4-2;7-5-3-1-2-4-6(8)9/h19H,3-18H2,1-2H3;14-15H,3-13H2,1-2H3;1-5H2,(H,8,9).
What are the key properties of 6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate?
6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate has a molecular weight of 800.88 g/mol, XLogP of 13.60, 33 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromohexanoic acid;2-hexyloctan-1-ol;2-hexyloctyl 6-bromohexanoate is sourced from PubChem (CID 165058234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).