C15H21BrN2O2S — CID 165059947
(S)-N-[(5-bromo-2-morpholin-4-ylphenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 165059947) has the molecular formula C15H21BrN2O2S and a molecular weight of 373.32 g/mol. Its IUPAC name is (S)-N-[(5-bromo-2-morpholin-4-ylphenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (S)-N-[(5-bromo-2-morpholin-4-ylphenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 165059947 |
| Molecular Formula | C15H21BrN2O2S |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | (S)-N-[(5-bromo-2-morpholin-4-ylphenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@](=O)N=Cc1cc(Br)ccc1N1CCOCC1 |
| InChI | InChI=1S/C15H21BrN2O2S/c1-15(2,3)21(19)17-11-12-10-13(16)4-5-14(12)18-6-8-20-9-7-18/h4-5,10-11H,6-9H2,1-3H3/t21-/m0/s1 |
| InChIKey | RAPGRBRJSZGRGV-NRFANRHFSA-N |
| XLogP | 3.17 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|