C27H23BrF2N6O3 — CID 165060950
5-bromo-3-fluoro-2-nitropyridine;1-(cyclopropylmethyl)-4-[[2-[4-fluoro-2-[(1R)-1-hydroxyethyl]phenyl]-3-pyridinyl]methyl]pyrazole-3-carbonitrile (PubChem CID 165060950) has the molecular formula C27H23BrF2N6O3 and a molecular weight of 597.42 g/mol. Its IUPAC name is 5-bromo-3-fluoro-2-nitropyridine;1-(cyclopropylmethyl)-4-[[2-[4-fluoro-2-[(1R)-1-hydroxyethyl]phenyl]-3-pyridinyl]methyl]pyrazole-3-carbonitrile.
| Compound Name | 5-bromo-3-fluoro-2-nitropyridine;1-(cyclopropylmethyl)-4-[[2-[4-fluoro-2-[(1R)-1-hydroxyethyl]phenyl]-3-pyridinyl]methyl]pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 165060950 |
| Molecular Formula | C27H23BrF2N6O3 |
| Molecular Weight | 597.42 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | 5-bromo-3-fluoro-2-nitropyridine;1-(cyclopropylmethyl)-4-[[2-[4-fluoro-2-[(1R)-1-hydroxyethyl]phenyl]-3-pyridinyl]methyl]pyrazole-3-carbonitrile |
| SMILES | C[C@@H](O)c1cc(F)ccc1-c1ncccc1Cc1cn(CC2CC2)nc1C#N.O=[N+]([O-])c1ncc(Br)cc1F |
| InChI | InChI=1S/C22H21FN4O.C5H2BrFN2O2/c1-14(28)20-10-18(23)6-7-19(20)22-16(3-2-8-25-22)9-17-13-27(12-15-4-5-15)26-21(17)11-24;6-3-1-4(7)5(8-2-3)9(10)11/h2-3,6-8,10,13-15,28H,4-5,9,12H2,1H3;1-2H/t14-;/m1./s1 |
| InChIKey | REOQGRHBXISZSG-PFEQFJNWSA-N |
| XLogP | 5.90 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.42 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|