C26H23BrFN5O3 — CID 164718570
5-bromo-3-[(1R)-1-[2-[3-[[1-(cyclopropylmethyl)pyrazol-4-yl]methyl]-2-pyridinyl]-5-fluorophenyl]ethoxy]-2-nitropyridine (PubChem CID 164718570) has the molecular formula C26H23BrFN5O3 and a molecular weight of 552.40 g/mol. Its IUPAC name is 5-bromo-3-[(1R)-1-[2-[3-[[1-(cyclopropylmethyl)pyrazol-4-yl]methyl]-2-pyridinyl]-5-fluorophenyl]ethoxy]-2-nitropyridine.
| Compound Name | 5-bromo-3-[(1R)-1-[2-[3-[[1-(cyclopropylmethyl)pyrazol-4-yl]methyl]-2-pyridinyl]-5-fluorophenyl]ethoxy]-2-nitropyridine |
|---|---|
| PubChem CID | 164718570 |
| Molecular Formula | C26H23BrFN5O3 |
| Molecular Weight | 552.40 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | 5-bromo-3-[(1R)-1-[2-[3-[[1-(cyclopropylmethyl)pyrazol-4-yl]methyl]-2-pyridinyl]-5-fluorophenyl]ethoxy]-2-nitropyridine |
| SMILES | C[C@@H](Oc1cc(Br)cnc1[N+](=O)[O-])c1cc(F)ccc1-c1ncccc1Cc1cnn(CC2CC2)c1 |
| InChI | InChI=1S/C26H23BrFN5O3/c1-16(36-24-10-20(27)13-30-26(24)33(34)35)23-11-21(28)6-7-22(23)25-19(3-2-8-29-25)9-18-12-31-32(15-18)14-17-4-5-17/h2-3,6-8,10-13,15-17H,4-5,9,14H2,1H3/t16-/m1/s1 |
| InChIKey | UJXSIFSERKGFFL-MRXNPFEDSA-N |
| XLogP | 6.29 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.40 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|