C23H21BrFN5O4 — CID 166559805
5-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]-4-[(1-ethylpyrazol-4-yl)methyl]-2-methyl-1,3-oxazole (PubChem CID 166559805) has the molecular formula C23H21BrFN5O4 and a molecular weight of 530.35 g/mol. Its IUPAC name is 5-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]-4-[(1-ethylpyrazol-4-yl)methyl]-2-methyl-1,3-oxazole.
| Compound Name | 5-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]-4-[(1-ethylpyrazol-4-yl)methyl]-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 166559805 |
| Molecular Formula | C23H21BrFN5O4 |
| Molecular Weight | 530.35 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | 5-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]-4-[(1-ethylpyrazol-4-yl)methyl]-2-methyl-1,3-oxazole |
| SMILES | CCn1cc(Cc2nc(C)oc2-c2ccc(F)cc2C(C)Oc2cc(Br)cnc2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C23H21BrFN5O4/c1-4-29-12-15(10-27-29)7-20-22(34-14(3)28-20)18-6-5-17(25)9-19(18)13(2)33-21-8-16(24)11-26-23(21)30(31)32/h5-6,8-13H,4,7H2,1-3H3 |
| InChIKey | RNLXWDCGIAHLGA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.35 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|