C23H21BrFN7O4 — CID 166560228
5-bromo-3-[(1R)-1-[5-fluoro-2-[2-methyl-5-[[1-(oxetan-3-yl)pyrazol-4-yl]methyl]triazol-4-yl]phenyl]ethoxy]-2-nitropyridine (PubChem CID 166560228) has the molecular formula C23H21BrFN7O4 and a molecular weight of 558.37 g/mol. Its IUPAC name is 5-bromo-3-[(1R)-1-[5-fluoro-2-[2-methyl-5-[[1-(oxetan-3-yl)pyrazol-4-yl]methyl]triazol-4-yl]phenyl]ethoxy]-2-nitropyridine.
| Compound Name | 5-bromo-3-[(1R)-1-[5-fluoro-2-[2-methyl-5-[[1-(oxetan-3-yl)pyrazol-4-yl]methyl]triazol-4-yl]phenyl]ethoxy]-2-nitropyridine |
|---|---|
| PubChem CID | 166560228 |
| Molecular Formula | C23H21BrFN7O4 |
| Molecular Weight | 558.37 g/mol |
| Exact Mass | 557.08 |
| IUPAC Name | 5-bromo-3-[(1R)-1-[5-fluoro-2-[2-methyl-5-[[1-(oxetan-3-yl)pyrazol-4-yl]methyl]triazol-4-yl]phenyl]ethoxy]-2-nitropyridine |
| SMILES | C[C@@H](Oc1cc(Br)cnc1[N+](=O)[O-])c1cc(F)ccc1-c1nn(C)nc1Cc1cnn(C2COC2)c1 |
| InChI | InChI=1S/C23H21BrFN7O4/c1-13(36-21-6-15(24)9-26-23(21)32(33)34)19-7-16(25)3-4-18(19)22-20(28-30(2)29-22)5-14-8-27-31(10-14)17-11-35-12-17/h3-4,6-10,13,17H,5,11-12H2,1-2H3/t13-/m1/s1 |
| InChIKey | PUCZRSJDHCFURA-CYBMUJFWSA-N |
| XLogP | 4.19 |
| TPSA | 123.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|