C24H19BrClF3N6O3 — CID 178128918
5-bromo-3-[(1R)-1-[2-[4-[1-(3-chloro-1-ethylpyrazol-4-yl)-2,2-difluoroethenyl]-1-methylpyrazol-3-yl]-5-fluorophenyl]ethoxy]-2-nitropyridine (PubChem CID 178128918) has the molecular formula C24H19BrClF3N6O3 and a molecular weight of 611.81 g/mol. Its IUPAC name is 5-bromo-3-[(1R)-1-[2-[4-[1-(3-chloro-1-ethylpyrazol-4-yl)-2,2-difluoroethenyl]-1-methylpyrazol-3-yl]-5-fluorophenyl]ethoxy]-2-nitropyridine.
| Compound Name | 5-bromo-3-[(1R)-1-[2-[4-[1-(3-chloro-1-ethylpyrazol-4-yl)-2,2-difluoroethenyl]-1-methylpyrazol-3-yl]-5-fluorophenyl]ethoxy]-2-nitropyridine |
|---|---|
| PubChem CID | 178128918 |
| Molecular Formula | C24H19BrClF3N6O3 |
| Molecular Weight | 611.81 g/mol |
| Exact Mass | 610.03 |
| IUPAC Name | 5-bromo-3-[(1R)-1-[2-[4-[1-(3-chloro-1-ethylpyrazol-4-yl)-2,2-difluoroethenyl]-1-methylpyrazol-3-yl]-5-fluorophenyl]ethoxy]-2-nitropyridine |
| SMILES | CCn1cc(C(=C(F)F)c2cn(C)nc2-c2ccc(F)cc2[C@@H](C)Oc2cc(Br)cnc2[N+](=O)[O-])c(Cl)n1 |
| InChI | InChI=1S/C24H19BrClF3N6O3/c1-4-34-11-18(22(26)32-34)20(23(28)29)17-10-33(3)31-21(17)15-6-5-14(27)8-16(15)12(2)38-19-7-13(25)9-30-24(19)35(36)37/h5-12H,4H2,1-3H3/t12-/m1/s1 |
| InChIKey | VWWHHIWIQYMIBD-GFCCVEGCSA-N |
| XLogP | 6.96 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.81 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|