C21H14BrFN6O3S — CID 164718944
1-[[4-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]-1,3-thiazol-5-yl]methyl]imidazole-4-carbonitrile (PubChem CID 164718944) has the molecular formula C21H14BrFN6O3S and a molecular weight of 529.35 g/mol. Its IUPAC name is 1-[[4-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]-1,3-thiazol-5-yl]methyl]imidazole-4-carbonitrile.
| Compound Name | 1-[[4-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]-1,3-thiazol-5-yl]methyl]imidazole-4-carbonitrile |
|---|---|
| PubChem CID | 164718944 |
| Molecular Formula | C21H14BrFN6O3S |
| Molecular Weight | 529.35 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | 1-[[4-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]-1,3-thiazol-5-yl]methyl]imidazole-4-carbonitrile |
| SMILES | CC(Oc1cc(Br)cnc1[N+](=O)[O-])c1cc(F)ccc1-c1ncsc1Cn1cnc(C#N)c1 |
| InChI | InChI=1S/C21H14BrFN6O3S/c1-12(32-18-4-13(22)7-25-21(18)29(30)31)17-5-14(23)2-3-16(17)20-19(33-11-27-20)9-28-8-15(6-24)26-10-28/h2-5,7-8,10-12H,9H2,1H3 |
| InChIKey | HLZVNQVKRFOOSU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 119.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.35 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|