C23H22BrFN6O4 — CID 164718959
5-bromo-3-[(1R)-1-[2-[5-[(1-ethylpyrazol-4-yl)methyl]-3-methoxypyrazol-1-yl]-5-fluorophenyl]ethoxy]-2-nitropyridine (PubChem CID 164718959) has the molecular formula C23H22BrFN6O4 and a molecular weight of 545.37 g/mol. Its IUPAC name is 5-bromo-3-[(1R)-1-[2-[5-[(1-ethylpyrazol-4-yl)methyl]-3-methoxypyrazol-1-yl]-5-fluorophenyl]ethoxy]-2-nitropyridine.
| Compound Name | 5-bromo-3-[(1R)-1-[2-[5-[(1-ethylpyrazol-4-yl)methyl]-3-methoxypyrazol-1-yl]-5-fluorophenyl]ethoxy]-2-nitropyridine |
|---|---|
| PubChem CID | 164718959 |
| Molecular Formula | C23H22BrFN6O4 |
| Molecular Weight | 545.37 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | 5-bromo-3-[(1R)-1-[2-[5-[(1-ethylpyrazol-4-yl)methyl]-3-methoxypyrazol-1-yl]-5-fluorophenyl]ethoxy]-2-nitropyridine |
| SMILES | CCn1cc(Cc2cc(OC)nn2-c2ccc(F)cc2[C@@H](C)Oc2cc(Br)cnc2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C23H22BrFN6O4/c1-4-29-13-15(11-27-29)7-18-10-22(34-3)28-30(18)20-6-5-17(25)9-19(20)14(2)35-21-8-16(24)12-26-23(21)31(32)33/h5-6,8-14H,4,7H2,1-3H3/t14-/m1/s1 |
| InChIKey | FSYDEENHZSVOIE-CQSZACIVSA-N |
| XLogP | 5.03 |
| TPSA | 110.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|