C22H17BrFN7O4 — CID 164719207
3-[[2-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]pyrazol-3-yl]-hydroxymethyl]-1-methylpyrazole-5-carbonitrile (PubChem CID 164719207) has the molecular formula C22H17BrFN7O4 and a molecular weight of 542.33 g/mol. Its IUPAC name is 3-[[2-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]pyrazol-3-yl]-hydroxymethyl]-1-methylpyrazole-5-carbonitrile.
| Compound Name | 3-[[2-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]pyrazol-3-yl]-hydroxymethyl]-1-methylpyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 164719207 |
| Molecular Formula | C22H17BrFN7O4 |
| Molecular Weight | 542.33 g/mol |
| Exact Mass | 541.05 |
| IUPAC Name | 3-[[2-[2-[1-[(5-bromo-2-nitro-3-pyridinyl)oxy]ethyl]-4-fluorophenyl]pyrazol-3-yl]-hydroxymethyl]-1-methylpyrazole-5-carbonitrile |
| SMILES | CC(Oc1cc(Br)cnc1[N+](=O)[O-])c1cc(F)ccc1-n1nccc1C(O)c1cc(C#N)n(C)n1 |
| InChI | InChI=1S/C22H17BrFN7O4/c1-12(35-20-7-13(23)11-26-22(20)31(33)34)16-8-14(24)3-4-18(16)30-19(5-6-27-30)21(32)17-9-15(10-25)29(2)28-17/h3-9,11-12,21,32H,1-2H3 |
| InChIKey | PLGZSNQOZXUJST-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|